C23H23F4N3O2 — CID 78319941
(6S)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-3-[3-methoxy-4-(trifluoromethyl)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine (PubChem CID 78319941) has the molecular formula C23H23F4N3O2 and a molecular weight of 449.45 g/mol. Its IUPAC name is (6S)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-3-[3-methoxy-4-(trifluoromethyl)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine.
| Compound Name | (6S)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-3-[3-methoxy-4-(trifluoromethyl)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
|---|---|
| PubChem CID | 78319941 |
| Molecular Formula | C23H23F4N3O2 |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (6S)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-3-[3-methoxy-4-(trifluoromethyl)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
| SMILES | COc1cc(-c2nc(-c3cc(C)nc(C)c3)c3n2C[C@@H](CF)OCC3)ccc1C(F)(F)F |
| InChI | InChI=1S/C23H23F4N3O2/c1-13-8-16(9-14(2)28-13)21-19-6-7-32-17(11-24)12-30(19)22(29-21)15-4-5-18(23(25,26)27)20(10-15)31-3/h4-5,8-10,17H,6-7,11-12H2,1-3H3/t17-/m1/s1 |
| InChIKey | XUJVELVSUPZHQP-QGZVFWFLSA-N |
| XLogP | 5.17 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |