C25H28Cl2FN5O2 — CID 78320288
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-[(2R)-2,4-dimethylpiperazin-1-yl]-4-methoxy-3-pyridinyl]pyridin-2-amine (PubChem CID 78320288) has the molecular formula C25H28Cl2FN5O2 and a molecular weight of 520.44 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-[(2R)-2,4-dimethylpiperazin-1-yl]-4-methoxy-3-pyridinyl]pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-[(2R)-2,4-dimethylpiperazin-1-yl]-4-methoxy-3-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 78320288 |
| Molecular Formula | C25H28Cl2FN5O2 |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-[(2R)-2,4-dimethylpiperazin-1-yl]-4-methoxy-3-pyridinyl]pyridin-2-amine |
| SMILES | COc1cc(N2CCN(C)C[C@H]2C)ncc1-c1cnc(N)c(OC(C)c2c(Cl)ccc(F)c2Cl)c1 |
| InChI | InChI=1S/C25H28Cl2FN5O2/c1-14-13-32(3)7-8-33(14)22-10-20(34-4)17(12-30-22)16-9-21(25(29)31-11-16)35-15(2)23-18(26)5-6-19(28)24(23)27/h5-6,9-12,14-15H,7-8,13H2,1-4H3,(H2,29,31)/t14-,15?/m1/s1 |
| InChIKey | BFLLIGAQWXSFEU-GICMACPYSA-N |
| XLogP | 5.46 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|