C22H22F3N3O2 — CID 78320559
(6S)-3-[4-(difluoromethoxy)-3-methylphenyl]-6-(fluoromethyl)-1-(2-methyl-4-pyridinyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine (PubChem CID 78320559) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is (6S)-3-[4-(difluoromethoxy)-3-methylphenyl]-6-(fluoromethyl)-1-(2-methyl-4-pyridinyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine.
| Compound Name | (6S)-3-[4-(difluoromethoxy)-3-methylphenyl]-6-(fluoromethyl)-1-(2-methyl-4-pyridinyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
|---|---|
| PubChem CID | 78320559 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (6S)-3-[4-(difluoromethoxy)-3-methylphenyl]-6-(fluoromethyl)-1-(2-methyl-4-pyridinyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
| SMILES | Cc1cc(-c2nc(-c3ccc(OC(F)F)c(C)c3)n3c2CCO[C@H](CF)C3)ccn1 |
| InChI | InChI=1S/C22H22F3N3O2/c1-13-9-16(3-4-19(13)30-22(24)25)21-27-20(15-5-7-26-14(2)10-15)18-6-8-29-17(11-23)12-28(18)21/h3-5,7,9-10,17,22H,6,8,11-12H2,1-2H3/t17-/m1/s1 |
| InChIKey | UBPRWPMYKSNHOG-QGZVFWFLSA-N |
| XLogP | 4.74 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |