C25H27FN10O — CID 78320626
3-[4-amino-1-[[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-5-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenol (PubChem CID 78320626) has the molecular formula C25H27FN10O and a molecular weight of 502.56 g/mol. Its IUPAC name is 3-[4-amino-1-[[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-5-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenol.
| Compound Name | 3-[4-amino-1-[[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-5-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenol |
|---|---|
| PubChem CID | 78320626 |
| Molecular Formula | C25H27FN10O |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 3-[4-amino-1-[[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-5-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenol |
| SMILES | Cc1ccn2nc(Cn3nc(-c4cc(O)cc(F)c4)c4c(N)ncnc43)nc(N3C[C@@H](C)N[C@@H](C)C3)c12 |
| InChI | InChI=1S/C25H27FN10O/c1-13-4-5-35-22(13)25(34-9-14(2)30-15(3)10-34)31-19(32-35)11-36-24-20(23(27)28-12-29-24)21(33-36)16-6-17(26)8-18(37)7-16/h4-8,12,14-15,30,37H,9-11H2,1-3H3,(H2,27,28,29)/t14-,15+ |
| InChIKey | NSXJRCJHPPXGFY-GASCZTMLSA-N |
| XLogP | 2.51 |
| TPSA | 135.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |