C20H14N2OS — CID 78320803
3-(4-ethenylphenyl)-7-phenylthieno[3,2-d]pyrimidin-4-one (PubChem CID 78320803) has the molecular formula C20H14N2OS and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-(4-ethenylphenyl)-7-phenylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(4-ethenylphenyl)-7-phenylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 78320803 |
| Molecular Formula | C20H14N2OS |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 3-(4-ethenylphenyl)-7-phenylthieno[3,2-d]pyrimidin-4-one |
| SMILES | C=Cc1ccc(-n2cnc3c(-c4ccccc4)csc3c2=O)cc1 |
| InChI | InChI=1S/C20H14N2OS/c1-2-14-8-10-16(11-9-14)22-13-21-18-17(12-24-19(18)20(22)23)15-6-4-3-5-7-15/h2-13H,1H2 |
| InChIKey | LMBNSWDDJGRCEX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |