C21H26F3N5O — CID 78320867
11-methyl-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one (PubChem CID 78320867) has the molecular formula C21H26F3N5O and a molecular weight of 421.47 g/mol. Its IUPAC name is 11-methyl-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one.
| Compound Name | 11-methyl-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
|---|---|
| PubChem CID | 78320867 |
| Molecular Formula | C21H26F3N5O |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 11-methyl-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
| SMILES | CN1CN(C2CCC(CNC3(C(F)(F)F)CC3)CC2)c2c(cnc3[nH]ccc23)C1=O |
| InChI | InChI=1S/C21H26F3N5O/c1-28-12-29(17-15-6-9-25-18(15)26-11-16(17)19(28)30)14-4-2-13(3-5-14)10-27-20(7-8-20)21(22,23)24/h6,9,11,13-14,27H,2-5,7-8,10,12H2,1H3,(H,25,26) |
| InChIKey | KNSNQUJTQSTIFH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |