C22H25F3N6O — CID 78320868
2-[10-oxo-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl]acetonitrile (PubChem CID 78320868) has the molecular formula C22H25F3N6O and a molecular weight of 446.48 g/mol. Its IUPAC name is 2-[10-oxo-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl]acetonitrile.
| Compound Name | 2-[10-oxo-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl]acetonitrile |
|---|---|
| PubChem CID | 78320868 |
| Molecular Formula | C22H25F3N6O |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-[10-oxo-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl]acetonitrile |
| SMILES | N#CCN1CN(C2CCC(CNC3(C(F)(F)F)CC3)CC2)c2c(cnc3[nH]ccc23)C1=O |
| InChI | InChI=1S/C22H25F3N6O/c23-22(24,25)21(6-7-21)29-11-14-1-3-15(4-2-14)31-13-30(10-8-26)20(32)17-12-28-19-16(18(17)31)5-9-27-19/h5,9,12,14-15,29H,1-4,6-7,10-11,13H2,(H,27,28) |
| InChIKey | JRXMDKBOTXUDNQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|