About 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole
5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole (PubChem CID 78320889) has the molecular formula C19H15F3N2O
and a molecular weight of 344.34 g/mol. Its IUPAC name is 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole.
Molecular Properties
| Compound Name | 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole |
| PubChem CID | 78320889 |
| Molecular Formula | C19H15F3N2O |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole |
| SMILES | COc1ccc2[nH]cc(C(c3c[nH]c4ccccc34)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C19H15F3N2O/c1-25-11-6-7-17-13(8-11)15(10-24-17)18(19(20,21)22)14-9-23-16-5-3-2-4-12(14)16/h2-10,18,23-24H,1H3 |
| InChIKey | ZGTGKQLLGMGKPJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole?
The IUPAC name of 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole (CID 78320889) is 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole.
What is the SMILES notation for 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole?
The canonical SMILES for 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole is COc1ccc2[nH]cc(C(c3c[nH]c4ccccc34)C(F)(F)F)c2c1.
What is the InChIKey of 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole?
The InChIKey is ZGTGKQLLGMGKPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F3N2O/c1-25-11-6-7-17-13(8-11)15(10-24-17)18(19(20,21)22)14-9-23-16-5-3-2-4-12(14)16/h2-10,18,23-24H,1H3.
What are the key properties of 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole?
5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole has a molecular weight of 344.34 g/mol, XLogP of 5.35, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole is sourced from PubChem (CID 78320889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).