C10H14O5S — CID 78321186
5-[(3aS,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid (PubChem CID 78321186) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 78321186 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid |
| SMILES | O=C(O)CCCC[C@@H]1SC[C@@H]2OC(=O)O[C@@H]21 |
| InChI | InChI=1S/C10H14O5S/c11-8(12)4-2-1-3-7-9-6(5-16-7)14-10(13)15-9/h6-7,9H,1-5H2,(H,11,12)/t6-,7-,9-/m0/s1 |
| InChIKey | ZTQRLBQVMMBZBX-ZKWXMUAHSA-N |
| XLogP | 1.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|