C25H30N4O3S — CID 78321297
(8S,9S,13S,14S)-13-methyl-17-pyrimidin-5-yl-N-(2-sulfamoylethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 78321297) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is (8S,9S,13S,14S)-13-methyl-17-pyrimidin-5-yl-N-(2-sulfamoylethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | (8S,9S,13S,14S)-13-methyl-17-pyrimidin-5-yl-N-(2-sulfamoylethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 78321297 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (8S,9S,13S,14S)-13-methyl-17-pyrimidin-5-yl-N-(2-sulfamoylethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(C(=O)NCCS(N)(=O)=O)cc4CC[C@H]3[C@@H]1CC=C2c1cncnc1 |
| InChI | InChI=1S/C25H30N4O3S/c1-25-9-8-20-19-4-3-17(24(30)29-10-11-33(26,31)32)12-16(19)2-5-21(20)23(25)7-6-22(25)18-13-27-15-28-14-18/h3-4,6,12-15,20-21,23H,2,5,7-11H2,1H3,(H,29,30)(H2,26,31,32)/t20-,21-,23+,25-/m1/s1 |
| InChIKey | FCIRGZUGDBOUQR-NTNMUZRVSA-N |
| XLogP | 3.04 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |