C7H7F3N4 — CID 78321345
(1S,7S)-3-(trifluoromethyl)-2,4,5,8-tetrazatricyclo[5.2.1.02,6]deca-3,5-diene (PubChem CID 78321345) has the molecular formula C7H7F3N4 and a molecular weight of 204.15 g/mol. Its IUPAC name is (1S,7S)-3-(trifluoromethyl)-2,4,5,8-tetrazatricyclo[5.2.1.02,6]deca-3,5-diene.
| Compound Name | (1S,7S)-3-(trifluoromethyl)-2,4,5,8-tetrazatricyclo[5.2.1.02,6]deca-3,5-diene |
|---|---|
| PubChem CID | 78321345 |
| Molecular Formula | C7H7F3N4 |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (1S,7S)-3-(trifluoromethyl)-2,4,5,8-tetrazatricyclo[5.2.1.02,6]deca-3,5-diene |
| SMILES | FC(F)(F)c1nnc2n1[C@@H]1CN[C@H]2C1 |
| InChI | InChI=1S/C7H7F3N4/c8-7(9,10)6-13-12-5-4-1-3(2-11-4)14(5)6/h3-4,11H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | XWXWDZITFWPGRB-IMJSIDKUSA-N |
| XLogP | 0.89 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |