C18H19N7O — CID 78321525
N-(2-methoxyethyl)-6-[5-(1-methylpyrazol-4-yl)-1H-indazol-3-yl]pyrimidin-4-amine (PubChem CID 78321525) has the molecular formula C18H19N7O and a molecular weight of 349.40 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6-[5-(1-methylpyrazol-4-yl)-1H-indazol-3-yl]pyrimidin-4-amine.
| Compound Name | N-(2-methoxyethyl)-6-[5-(1-methylpyrazol-4-yl)-1H-indazol-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 78321525 |
| Molecular Formula | C18H19N7O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-(2-methoxyethyl)-6-[5-(1-methylpyrazol-4-yl)-1H-indazol-3-yl]pyrimidin-4-amine |
| SMILES | COCCNc1cc(-c2n[nH]c3ccc(-c4cnn(C)c4)cc23)ncn1 |
| InChI | InChI=1S/C18H19N7O/c1-25-10-13(9-22-25)12-3-4-15-14(7-12)18(24-23-15)16-8-17(21-11-20-16)19-5-6-26-2/h3-4,7-11H,5-6H2,1-2H3,(H,23,24)(H,19,20,21) |
| InChIKey | LLLFPOVCUDKEPY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|