C19H14F4O4S — CID 78321651
1-(3-methoxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butane-1,4-dione (PubChem CID 78321651) has the molecular formula C19H14F4O4S and a molecular weight of 414.38 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butane-1,4-dione.
| Compound Name | 1-(3-methoxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 78321651 |
| Molecular Formula | C19H14F4O4S |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 1-(3-methoxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butane-1,4-dione |
| SMILES | COc1cccc(C(=O)CCC(=O)c2ccc3c(c2)SC(F)(F)C(F)(F)O3)c1 |
| InChI | InChI=1S/C19H14F4O4S/c1-26-13-4-2-3-11(9-13)14(24)6-7-15(25)12-5-8-16-17(10-12)28-19(22,23)18(20,21)27-16/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | GMIMWJQTNOIKHN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|