C25H29O8P — CID 78321923
[(3aR,4R,6R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-yl] benzoate (PubChem CID 78321923) has the molecular formula C25H29O8P and a molecular weight of 488.47 g/mol. Its IUPAC name is [(3aR,4R,6R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-yl] benzoate.
| Compound Name | [(3aR,4R,6R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-yl] benzoate |
|---|---|
| PubChem CID | 78321923 |
| Molecular Formula | C25H29O8P |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | [(3aR,4R,6R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-yl] benzoate |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H]3COC(C)(C)O3)O[P@](=O)(c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C25H29O8P/c1-24(2)28-15-18(30-24)19-20-21(32-25(3,4)31-20)23(29-22(26)16-11-7-5-8-12-16)34(27,33-19)17-13-9-6-10-14-17/h5-14,18-21,23H,15H2,1-4H3/t18-,19-,20+,21+,23-,34-/m1/s1 |
| InChIKey | SFTPJRPHQMDNLY-DDNJDZIRSA-N |
| XLogP | 3.84 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|