C25H19F3N6O2S — CID 78322097
5-[5-phenyl-4-[(2,2,2-trifluoro-1-phenylethyl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide (PubChem CID 78322097) has the molecular formula C25H19F3N6O2S and a molecular weight of 524.53 g/mol. Its IUPAC name is 5-[5-phenyl-4-[(2,2,2-trifluoro-1-phenylethyl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide.
| Compound Name | 5-[5-phenyl-4-[(2,2,2-trifluoro-1-phenylethyl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 78322097 |
| Molecular Formula | C25H19F3N6O2S |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 5-[5-phenyl-4-[(2,2,2-trifluoro-1-phenylethyl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cncc(-c2nc(NC(c3ccccc3)C(F)(F)F)c3c(-c4ccccc4)ccn3n2)c1 |
| InChI | InChI=1S/C25H19F3N6O2S/c26-25(27,28)22(17-9-5-2-6-10-17)31-24-21-20(16-7-3-1-4-8-16)11-12-34(21)33-23(32-24)18-13-19(15-30-14-18)37(29,35)36/h1-15,22H,(H2,29,35,36)(H,31,32,33) |
| InChIKey | STFDNCBDEBFHBH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |