C25H21F5N4O2S — CID 78322122
(2S)-N-(1-cyanocyclopropyl)-3-(3,5-difluoro-4-hydroxyphenyl)-2-[[(1S)-2,2,2-trifluoro-1-[3-(4-methyl-1,3-thiazol-2-yl)phenyl]ethyl]amino]propanamide (PubChem CID 78322122) has the molecular formula C25H21F5N4O2S and a molecular weight of 536.53 g/mol. Its IUPAC name is (2S)-N-(1-cyanocyclopropyl)-3-(3,5-difluoro-4-hydroxyphenyl)-2-[[(1S)-2,2,2-trifluoro-1-[3-(4-methyl-1,3-thiazol-2-yl)phenyl]ethyl]amino]propanamide.
| Compound Name | (2S)-N-(1-cyanocyclopropyl)-3-(3,5-difluoro-4-hydroxyphenyl)-2-[[(1S)-2,2,2-trifluoro-1-[3-(4-methyl-1,3-thiazol-2-yl)phenyl]ethyl]amino]propanamide |
|---|---|
| PubChem CID | 78322122 |
| Molecular Formula | C25H21F5N4O2S |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | (2S)-N-(1-cyanocyclopropyl)-3-(3,5-difluoro-4-hydroxyphenyl)-2-[[(1S)-2,2,2-trifluoro-1-[3-(4-methyl-1,3-thiazol-2-yl)phenyl]ethyl]amino]propanamide |
| SMILES | Cc1csc(-c2cccc([C@H](N[C@@H](Cc3cc(F)c(O)c(F)c3)C(=O)NC3(C#N)CC3)C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C25H21F5N4O2S/c1-13-11-37-23(32-13)16-4-2-3-15(10-16)21(25(28,29)30)33-19(22(36)34-24(12-31)5-6-24)9-14-7-17(26)20(35)18(27)8-14/h2-4,7-8,10-11,19,21,33,35H,5-6,9H2,1H3,(H,34,36)/t19-,21-/m0/s1 |
| InChIKey | HRKBMSHUHBQIMR-FPOVZHCZSA-N |
| XLogP | 5.08 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |