C17H11F4NO4 — CID 78322273
1-pyridin-2-yl-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione (PubChem CID 78322273) has the molecular formula C17H11F4NO4 and a molecular weight of 369.27 g/mol. Its IUPAC name is 1-pyridin-2-yl-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione.
| Compound Name | 1-pyridin-2-yl-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 78322273 |
| Molecular Formula | C17H11F4NO4 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1-pyridin-2-yl-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccccn1)c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C17H11F4NO4/c18-16(19)17(20,21)26-15-9-10(4-7-14(15)25-16)12(23)5-6-13(24)11-3-1-2-8-22-11/h1-4,7-9H,5-6H2 |
| InChIKey | FUIOAIJKURCLGU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|