C27H19ClFN3O — CID 78322388
4-chloro-8-(4-fluorophenyl)-15-methyl-9-phenyl-8,12,15-triazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2(7),3,5,10,14(17)-hexaen-13-one (PubChem CID 78322388) has the molecular formula C27H19ClFN3O and a molecular weight of 455.92 g/mol. Its IUPAC name is 4-chloro-8-(4-fluorophenyl)-15-methyl-9-phenyl-8,12,15-triazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2(7),3,5,10,14(17)-hexaen-13-one.
| Compound Name | 4-chloro-8-(4-fluorophenyl)-15-methyl-9-phenyl-8,12,15-triazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2(7),3,5,10,14(17)-hexaen-13-one |
|---|---|
| PubChem CID | 78322388 |
| Molecular Formula | C27H19ClFN3O |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 4-chloro-8-(4-fluorophenyl)-15-methyl-9-phenyl-8,12,15-triazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2(7),3,5,10,14(17)-hexaen-13-one |
| SMILES | Cn1cc2c3c(c[nH]c(=O)c31)C(c1ccccc1)N(c1ccc(F)cc1)c1ccc(Cl)cc1-2 |
| InChI | InChI=1S/C27H19ClFN3O/c1-31-15-22-20-13-17(28)7-12-23(20)32(19-10-8-18(29)9-11-19)25(16-5-3-2-4-6-16)21-14-30-27(33)26(31)24(21)22/h2-15,25H,1H3,(H,30,33) |
| InChIKey | RUGFSNXAERHPPZ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |