C18H17NO3 — CID 78322586
1-(3,4-dihydro-2H-chromen-7-yl)-4-pyridin-4-ylbutane-1,4-dione (PubChem CID 78322586) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-7-yl)-4-pyridin-4-ylbutane-1,4-dione.
| Compound Name | 1-(3,4-dihydro-2H-chromen-7-yl)-4-pyridin-4-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 78322586 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-7-yl)-4-pyridin-4-ylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)OCCC2)c1ccncc1 |
| InChI | InChI=1S/C18H17NO3/c20-16(13-7-9-19-10-8-13)5-6-17(21)15-4-3-14-2-1-11-22-18(14)12-15/h3-4,7-10,12H,1-2,5-6,11H2 |
| InChIKey | BLEAMKCRARUDIR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |