About 3-hydroxyphenanthro[9,10-d]triazole
3-hydroxyphenanthro[9,10-d]triazole (PubChem CID 7832260) has the molecular formula C14H9N3O
and a molecular weight of 235.25 g/mol. Its IUPAC name is 3-hydroxyphenanthro[9,10-d]triazole.
Molecular Properties
| Compound Name | 3-hydroxyphenanthro[9,10-d]triazole |
| PubChem CID | 7832260 |
| Molecular Formula | C14H9N3O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3-hydroxyphenanthro[9,10-d]triazole |
| SMILES | On1nnc2c3ccccc3c3ccccc3c21 |
| InChI | InChI=1S/C14H9N3O/c18-17-14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(14)15-16-17/h1-8,18H |
| InChIKey | IHZPELKKLUAFQF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyphenanthro[9,10-d]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyphenanthro[9,10-d]triazole?
The IUPAC name of 3-hydroxyphenanthro[9,10-d]triazole (CID 7832260) is 3-hydroxyphenanthro[9,10-d]triazole.
What is the SMILES notation for 3-hydroxyphenanthro[9,10-d]triazole?
The canonical SMILES for 3-hydroxyphenanthro[9,10-d]triazole is On1nnc2c3ccccc3c3ccccc3c21.
What is the InChIKey of 3-hydroxyphenanthro[9,10-d]triazole?
The InChIKey is IHZPELKKLUAFQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O/c18-17-14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(14)15-16-17/h1-8,18H.
What are the key properties of 3-hydroxyphenanthro[9,10-d]triazole?
3-hydroxyphenanthro[9,10-d]triazole has a molecular weight of 235.25 g/mol, XLogP of 2.97, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyphenanthro[9,10-d]triazole is sourced from PubChem (CID 7832260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).