C21H30FN2O3P — CID 78322668
3-[[4-fluoro-5-(6-phenylhexyl)-2-pyridinyl]methylamino]propylphosphonic acid (PubChem CID 78322668) has the molecular formula C21H30FN2O3P and a molecular weight of 408.45 g/mol. Its IUPAC name is 3-[[4-fluoro-5-(6-phenylhexyl)-2-pyridinyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-fluoro-5-(6-phenylhexyl)-2-pyridinyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 78322668 |
| Molecular Formula | C21H30FN2O3P |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-[[4-fluoro-5-(6-phenylhexyl)-2-pyridinyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(F)c(CCCCCCc2ccccc2)cn1 |
| InChI | InChI=1S/C21H30FN2O3P/c22-21-15-20(17-23-13-8-14-28(25,26)27)24-16-19(21)12-7-2-1-4-9-18-10-5-3-6-11-18/h3,5-6,10-11,15-16,23H,1-2,4,7-9,12-14,17H2,(H2,25,26,27) |
| InChIKey | AADMYHOMJYRDIL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|