About 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide
4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide (PubChem CID 78323117) has the molecular formula C16H15ClFNO
and a molecular weight of 291.75 g/mol. Its IUPAC name is 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide.
Molecular Properties
| Compound Name | 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide |
| PubChem CID | 78323117 |
| Molecular Formula | C16H15ClFNO |
| Molecular Weight | 291.75 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide |
| SMILES | C[N+](C)([O-])c1ccc(/C=C/c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H15ClFNO/c1-19(2,20)13-9-6-12(7-10-13)8-11-14-15(17)4-3-5-16(14)18/h3-11H,1-2H3/b11-8+ |
| InChIKey | LGTMJMFBGDPHFK-DHZHZOJOSA-N |
| XLogP | 4.71 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.75 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide?
The IUPAC name of 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide (CID 78323117) is 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide.
What is the SMILES notation for 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide?
The canonical SMILES for 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide is C[N+](C)([O-])c1ccc(/C=C/c2c(F)cccc2Cl)cc1.
What is the InChIKey of 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide?
The InChIKey is LGTMJMFBGDPHFK-DHZHZOJOSA-N. The full InChI is InChI=1S/C16H15ClFNO/c1-19(2,20)13-9-6-12(7-10-13)8-11-14-15(17)4-3-5-16(14)18/h3-11H,1-2H3/b11-8+.
What are the key properties of 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide?
4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide has a molecular weight of 291.75 g/mol, XLogP of 4.71, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylbenzeneamine oxide is sourced from PubChem (CID 78323117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).