C26H36F2NO3P — CID 78323297
3-[[2,5-difluoro-4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 78323297) has the molecular formula C26H36F2NO3P and a molecular weight of 479.55 g/mol. Its IUPAC name is 3-[[2,5-difluoro-4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[2,5-difluoro-4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 78323297 |
| Molecular Formula | C26H36F2NO3P |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 3-[[2,5-difluoro-4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(F)c(CCCCCC2(c3ccccc3)CCCC2)cc1F |
| InChI | InChI=1S/C26H36F2NO3P/c27-24-19-22(20-29-16-9-17-33(30,31)32)25(28)18-21(24)10-3-2-6-13-26(14-7-8-15-26)23-11-4-1-5-12-23/h1,4-5,11-12,18-19,29H,2-3,6-10,13-17,20H2,(H2,30,31,32) |
| InChIKey | XMMQNTLONACLKF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|