C28H40N4O11 — CID 78323333
(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoylamino]hexanoate (PubChem CID 78323333) has the molecular formula C28H40N4O11 and a molecular weight of 608.65 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 78323333 |
| Molecular Formula | C28H40N4O11 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoylamino]hexanoate |
| SMILES | O=C(CCCCCNC(=O)CCCCCN1C(=O)C=CC1=O)NCCCCCC(=O)OCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C28H40N4O11/c33-21(10-4-1-7-17-29-22(34)11-5-3-9-19-31-23(35)13-14-24(31)36)30-18-8-2-6-12-27(39)41-20-42-28(40)43-32-25(37)15-16-26(32)38/h13-14H,1-12,15-20H2,(H,29,34)(H,30,33) |
| InChIKey | UJRSZVQEBOBZDJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 194.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|