C18H25N6O+ — CID 7832344
(E)-2-(5-methyltetrazol-1-yl)-3-phenyl-1-(4-propylpiperazin-4-ium-1-yl)prop-2-en-1-one (PubChem CID 7832344) has the molecular formula C18H25N6O+ and a molecular weight of 341.44 g/mol. Its IUPAC name is (E)-2-(5-methyltetrazol-1-yl)-3-phenyl-1-(4-propylpiperazin-4-ium-1-yl)prop-2-en-1-one.
| Compound Name | (E)-2-(5-methyltetrazol-1-yl)-3-phenyl-1-(4-propylpiperazin-4-ium-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7832344 |
| Molecular Formula | C18H25N6O+ |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (E)-2-(5-methyltetrazol-1-yl)-3-phenyl-1-(4-propylpiperazin-4-ium-1-yl)prop-2-en-1-one |
| SMILES | CCC[NH+]1CCN(C(=O)/C(=C\c2ccccc2)n2nnnc2C)CC1 |
| InChI | InChI=1S/C18H24N6O/c1-3-9-22-10-12-23(13-11-22)18(25)17(24-15(2)19-20-21-24)14-16-7-5-4-6-8-16/h4-8,14H,3,9-13H2,1-2H3/p+1/b17-14+ |
| InChIKey | IWBLZVHMRBVDPL-SAPNQHFASA-O |
| XLogP | 0.12 |
| TPSA | 68.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|