C25H28N2O2 — CID 78323501
(8S,9S,13S,14S)-17-(5-methoxy-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 78323501) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (8S,9S,13S,14S)-17-(5-methoxy-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | (8S,9S,13S,14S)-17-(5-methoxy-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 78323501 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (8S,9S,13S,14S)-17-(5-methoxy-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | COc1cncc(C2=CC[C@H]3[C@@H]4CCc5cc(C(N)=O)ccc5[C@H]4CC[C@]23C)c1 |
| InChI | InChI=1S/C25H28N2O2/c1-25-10-9-20-19-5-4-16(24(26)28)11-15(19)3-6-21(20)23(25)8-7-22(25)17-12-18(29-2)14-27-13-17/h4-5,7,11-14,20-21,23H,3,6,8-10H2,1-2H3,(H2,26,28)/t20-,21-,23+,25-/m1/s1 |
| InChIKey | ZVLMRGDDCGPHIF-NTNMUZRVSA-N |
| XLogP | 4.74 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |