C24H32F2NO4P — CID 78323625
3-[[2,5-difluoro-4-[5-(3-phenyloxetan-3-yl)pentyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 78323625) has the molecular formula C24H32F2NO4P and a molecular weight of 467.49 g/mol. Its IUPAC name is 3-[[2,5-difluoro-4-[5-(3-phenyloxetan-3-yl)pentyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[2,5-difluoro-4-[5-(3-phenyloxetan-3-yl)pentyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 78323625 |
| Molecular Formula | C24H32F2NO4P |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 3-[[2,5-difluoro-4-[5-(3-phenyloxetan-3-yl)pentyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(F)c(CCCCCC2(c3ccccc3)COC2)cc1F |
| InChI | InChI=1S/C24H32F2NO4P/c25-22-15-20(16-27-12-7-13-32(28,29)30)23(26)14-19(22)8-3-2-6-11-24(17-31-18-24)21-9-4-1-5-10-21/h1,4-5,9-10,14-15,27H,2-3,6-8,11-13,16-18H2,(H2,28,29,30) |
| InChIKey | ANVHSGPJOUFWGN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|