C24H31N3O10 — CID 78323659
(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoate (PubChem CID 78323659) has the molecular formula C24H31N3O10 and a molecular weight of 521.52 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 78323659 |
| Molecular Formula | C24H31N3O10 |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoate |
| SMILES | O=C(CCCCCNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)OCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H31N3O10/c28-18-9-10-19(29)26(18)14-16-5-7-17(8-6-16)23(33)25-13-3-1-2-4-22(32)35-15-36-24(34)37-27-20(30)11-12-21(27)31/h9-10,16-17H,1-8,11-15H2,(H,25,33) |
| InChIKey | VIJMYOROZVDDRC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|