C19H24F3N5O3S — CID 78323708
2,2,2-trifluoro-N-[[4-(11-methyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclohexyl]methyl]ethanesulfonamide (PubChem CID 78323708) has the molecular formula C19H24F3N5O3S and a molecular weight of 459.49 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[4-(11-methyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclohexyl]methyl]ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-[[4-(11-methyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclohexyl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 78323708 |
| Molecular Formula | C19H24F3N5O3S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[[4-(11-methyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclohexyl]methyl]ethanesulfonamide |
| SMILES | CN1CN(C2CCC(CNS(=O)(=O)CC(F)(F)F)CC2)c2c(cnc3[nH]ccc23)C1=O |
| InChI | InChI=1S/C19H24F3N5O3S/c1-26-11-27(16-14-6-7-23-17(14)24-9-15(16)18(26)28)13-4-2-12(3-5-13)8-25-31(29,30)10-19(20,21)22/h6-7,9,12-13,25H,2-5,8,10-11H2,1H3,(H,23,24) |
| InChIKey | XMAKJOUTQJRPHN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |