C24H24F2N2O — CID 78323824
(8S,9S,11S,13S,14S)-11-fluoro-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 78323824) has the molecular formula C24H24F2N2O and a molecular weight of 394.47 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S)-11-fluoro-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | (8S,9S,11S,13S,14S)-11-fluoro-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 78323824 |
| Molecular Formula | C24H24F2N2O |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (8S,9S,11S,13S,14S)-11-fluoro-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | C[C@]12C[C@H](F)[C@@H]3c4ccc(C(N)=O)cc4CC[C@H]3[C@@H]1CC=C2c1cncc(F)c1 |
| InChI | InChI=1S/C24H24F2N2O/c1-24-10-21(26)22-17-4-3-14(23(27)29)8-13(17)2-5-18(22)20(24)7-6-19(24)15-9-16(25)12-28-11-15/h3-4,6,8-9,11-12,18,20-22H,2,5,7,10H2,1H3,(H2,27,29)/t18-,20-,21-,22+,24+/m0/s1 |
| InChIKey | RSVKUIAVQBOLPU-PVSVRJGFSA-N |
| XLogP | 4.82 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |