C23H27F2NO6 — CID 78323917
[7-[3,5-dihydroxy-4-(5-methoxy-2-prop-1-en-2-ylphenyl)phenyl]-7,7-difluoroheptyl] nitrate (PubChem CID 78323917) has the molecular formula C23H27F2NO6 and a molecular weight of 451.47 g/mol. Its IUPAC name is [7-[3,5-dihydroxy-4-(5-methoxy-2-prop-1-en-2-ylphenyl)phenyl]-7,7-difluoroheptyl] nitrate.
| Compound Name | [7-[3,5-dihydroxy-4-(5-methoxy-2-prop-1-en-2-ylphenyl)phenyl]-7,7-difluoroheptyl] nitrate |
|---|---|
| PubChem CID | 78323917 |
| Molecular Formula | C23H27F2NO6 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | [7-[3,5-dihydroxy-4-(5-methoxy-2-prop-1-en-2-ylphenyl)phenyl]-7,7-difluoroheptyl] nitrate |
| SMILES | C=C(C)c1ccc(OC)cc1-c1c(O)cc(C(F)(F)CCCCCCO[N+](=O)[O-])cc1O |
| InChI | InChI=1S/C23H27F2NO6/c1-15(2)18-9-8-17(31-3)14-19(18)22-20(27)12-16(13-21(22)28)23(24,25)10-6-4-5-7-11-32-26(29)30/h8-9,12-14,27-28H,1,4-7,10-11H2,2-3H3 |
| InChIKey | OFHPMQUIGDWNNP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|