C18H21N5O2 — CID 78324309
2-[13-[4-(hydroxymethyl)cyclohexyl]-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl]acetonitrile (PubChem CID 78324309) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-[13-[4-(hydroxymethyl)cyclohexyl]-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl]acetonitrile.
| Compound Name | 2-[13-[4-(hydroxymethyl)cyclohexyl]-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl]acetonitrile |
|---|---|
| PubChem CID | 78324309 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-[13-[4-(hydroxymethyl)cyclohexyl]-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl]acetonitrile |
| SMILES | N#CCN1CN(C2CCC(CO)CC2)c2c(cnc3[nH]ccc23)C1=O |
| InChI | InChI=1S/C18H21N5O2/c19-6-8-22-11-23(13-3-1-12(10-24)2-4-13)16-14-5-7-20-17(14)21-9-15(16)18(22)25/h5,7,9,12-13,24H,1-4,8,10-11H2,(H,20,21) |
| InChIKey | YEXKSMKNDTTWPA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|