About 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione
5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione (PubChem CID 78324504) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione |
| PubChem CID | 78324504 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(CC(=O)c2ccccc2)C(=O)C1(C)C1CCC1 |
| InChI | InChI=1S/C17H20N2O3/c1-17(13-9-6-10-13)15(21)19(16(22)18(17)2)11-14(20)12-7-4-3-5-8-12/h3-5,7-8,13H,6,9-11H2,1-2H3 |
| InChIKey | OJYSZNOBHDGBCR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione?
The IUPAC name of 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione (CID 78324504) is 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione.
What is the SMILES notation for 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione?
The canonical SMILES for 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione is CN1C(=O)N(CC(=O)c2ccccc2)C(=O)C1(C)C1CCC1.
What is the InChIKey of 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione?
The InChIKey is OJYSZNOBHDGBCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O3/c1-17(13-9-6-10-13)15(21)19(16(22)18(17)2)11-14(20)12-7-4-3-5-8-12/h3-5,7-8,13H,6,9-11H2,1-2H3.
What are the key properties of 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione?
5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione has a molecular weight of 300.36 g/mol, XLogP of 2.32, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclobutyl-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione is sourced from PubChem (CID 78324504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).