C23H20N8O3S — CID 78324584
5-[5-phenyl-4-(2-pyrazin-2-yloxyethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide (PubChem CID 78324584) has the molecular formula C23H20N8O3S and a molecular weight of 488.53 g/mol. Its IUPAC name is 5-[5-phenyl-4-(2-pyrazin-2-yloxyethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide.
| Compound Name | 5-[5-phenyl-4-(2-pyrazin-2-yloxyethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 78324584 |
| Molecular Formula | C23H20N8O3S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 5-[5-phenyl-4-(2-pyrazin-2-yloxyethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cncc(-c2nc(NCCOc3cnccn3)c3c(-c4ccccc4)ccn3n2)c1 |
| InChI | InChI=1S/C23H20N8O3S/c24-35(32,33)18-12-17(13-26-14-18)22-29-23(28-9-11-34-20-15-25-7-8-27-20)21-19(6-10-31(21)30-22)16-4-2-1-3-5-16/h1-8,10,12-15H,9,11H2,(H2,24,32,33)(H,28,29,30) |
| InChIKey | VHGVYEFZYNYAIC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 150.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|