C27H28F4N2O2 — CID 78324728
(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 78324728) has the molecular formula C27H28F4N2O2 and a molecular weight of 488.53 g/mol. Its IUPAC name is (8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | (8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 78324728 |
| Molecular Formula | C27H28F4N2O2 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(C(=O)NCC(O)C(F)(F)F)cc4CC[C@H]3[C@@H]1CC=C2c1cncc(F)c1 |
| InChI | InChI=1S/C27H28F4N2O2/c1-26-9-8-20-19-4-3-16(25(35)33-14-24(34)27(29,30)31)10-15(19)2-5-21(20)23(26)7-6-22(26)17-11-18(28)13-32-12-17/h3-4,6,10-13,20-21,23-24,34H,2,5,7-9,14H2,1H3,(H,33,35)/t20-,21-,23+,24?,26-/m1/s1 |
| InChIKey | CZDJVZYKNVTSJL-LFMQFWLSSA-N |
| XLogP | 5.42 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |