C18H11FN2OS — CID 78324866
3-(2-fluorophenyl)-7-phenylthieno[3,2-d]pyrimidin-4-one (PubChem CID 78324866) has the molecular formula C18H11FN2OS and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-7-phenylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(2-fluorophenyl)-7-phenylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 78324866 |
| Molecular Formula | C18H11FN2OS |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-(2-fluorophenyl)-7-phenylthieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2scc(-c3ccccc3)c2ncn1-c1ccccc1F |
| InChI | InChI=1S/C18H11FN2OS/c19-14-8-4-5-9-15(14)21-11-20-16-13(10-23-17(16)18(21)22)12-6-2-1-3-7-12/h1-11H |
| InChIKey | ZTOAXEZHBPCZRO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |