C32H30ClF5N8O4 — CID 78325047
N-[3-[[6-[[6-[(4-chlorophenyl)methylamino]-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]pyridine-3-carbonyl]amino]-2,2-dimethylpropyl]-N'-(2,4-difluorophenyl)oxamide (PubChem CID 78325047) has the molecular formula C32H30ClF5N8O4 and a molecular weight of 721.09 g/mol. Its IUPAC name is N-[3-[[6-[[6-[(4-chlorophenyl)methylamino]-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]pyridine-3-carbonyl]amino]-2,2-dimethylpropyl]-N'-(2,4-difluorophenyl)oxamide.
| Compound Name | N-[3-[[6-[[6-[(4-chlorophenyl)methylamino]-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]pyridine-3-carbonyl]amino]-2,2-dimethylpropyl]-N'-(2,4-difluorophenyl)oxamide |
|---|---|
| PubChem CID | 78325047 |
| Molecular Formula | C32H30ClF5N8O4 |
| Molecular Weight | 721.09 g/mol |
| Exact Mass | 720.20 |
| IUPAC Name | N-[3-[[6-[[6-[(4-chlorophenyl)methylamino]-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]pyridine-3-carbonyl]amino]-2,2-dimethylpropyl]-N'-(2,4-difluorophenyl)oxamide |
| SMILES | CC(C)(CNC(=O)C(=O)Nc1ccc(F)cc1F)CNC(=O)c1ccc(Nc2cc(NCc3ccc(Cl)cc3)nc(OCC(F)(F)F)n2)nc1 |
| InChI | InChI=1S/C32H30ClF5N8O4/c1-31(2,16-42-28(48)29(49)43-23-9-8-21(34)11-22(23)35)15-41-27(47)19-5-10-24(40-14-19)44-26-12-25(39-13-18-3-6-20(33)7-4-18)45-30(46-26)50-17-32(36,37)38/h3-12,14H,13,15-17H2,1-2H3,(H,41,47)(H,42,48)(H,43,49)(H2,39,40,44,45,46) |
| InChIKey | QLFZZCYISKEHJA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.09 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|