About N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide
N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide (PubChem CID 78327447) has the molecular formula C15H17N3O3
and a molecular weight of 287.32 g/mol. Its IUPAC name is N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide |
| PubChem CID | 78327447 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)N=C2C=CC=CC2C1=O)NC1CCCC1 |
| InChI | InChI=1S/C15H17N3O3/c19-13(16-10-5-1-2-6-10)9-18-14(20)11-7-3-4-8-12(11)17-15(18)21/h3-4,7-8,10-11H,1-2,5-6,9H2,(H,16,19) |
| InChIKey | PVGPLJHUAUAQCL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide?
The IUPAC name of N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide (CID 78327447) is N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide.
What is the SMILES notation for N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide?
The canonical SMILES for N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide is O=C(CN1C(=O)N=C2C=CC=CC2C1=O)NC1CCCC1.
What is the InChIKey of N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide?
The InChIKey is PVGPLJHUAUAQCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3/c19-13(16-10-5-1-2-6-10)9-18-14(20)11-7-3-4-8-12(11)17-15(18)21/h3-4,7-8,10-11H,1-2,5-6,9H2,(H,16,19).
What are the key properties of N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide?
N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide has a molecular weight of 287.32 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-(2,4-dioxo-4aH-quinazolin-3-yl)acetamide is sourced from PubChem (CID 78327447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).