C19H26ClN5O2 — CID 78327970
9-(4-chlorophenyl)-1,7-dimethyl-3-propyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 78327970) has the molecular formula C19H26ClN5O2 and a molecular weight of 391.90 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-1,7-dimethyl-3-propyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 9-(4-chlorophenyl)-1,7-dimethyl-3-propyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 78327970 |
| Molecular Formula | C19H26ClN5O2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 9-(4-chlorophenyl)-1,7-dimethyl-3-propyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | CCCN1C(=O)C2C(NC3N(c4ccc(Cl)cc4)CC(C)CN23)N(C)C1=O |
| InChI | InChI=1S/C19H26ClN5O2/c1-4-9-23-17(26)15-16(22(3)19(23)27)21-18-24(10-12(2)11-25(15)18)14-7-5-13(20)6-8-14/h5-8,12,15-16,18,21H,4,9-11H2,1-3H3 |
| InChIKey | ZKWOZGCXXDHELR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |