C19H18Cl3NO2 — CID 7832813
(2R)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(2,4,5-trichlorophenoxy)propanamide (PubChem CID 7832813) has the molecular formula C19H18Cl3NO2 and a molecular weight of 398.72 g/mol. Its IUPAC name is (2R)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(2,4,5-trichlorophenoxy)propanamide.
| Compound Name | (2R)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(2,4,5-trichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 7832813 |
| Molecular Formula | C19H18Cl3NO2 |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | (2R)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(2,4,5-trichlorophenoxy)propanamide |
| SMILES | C[C@@H](Oc1cc(Cl)c(Cl)cc1Cl)C(=O)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C19H18Cl3NO2/c1-11(25-18-10-15(21)14(20)9-16(18)22)19(24)23-17-8-4-6-12-5-2-3-7-13(12)17/h2-3,5,7,9-11,17H,4,6,8H2,1H3,(H,23,24)/t11-,17+/m1/s1 |
| InChIKey | MMELSCCCPAGOSN-DIFFPNOSSA-N |
| XLogP | 5.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|