About (2R)-2-hydroxyhexanamide
(2R)-2-hydroxyhexanamide (PubChem CID 78333430) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is (2R)-2-hydroxyhexanamide.
Molecular Properties
| Compound Name | (2R)-2-hydroxyhexanamide |
| PubChem CID | 78333430 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (2R)-2-hydroxyhexanamide |
| SMILES | CCCC[C@@H](O)C(N)=O |
| InChI | InChI=1S/C6H13NO2/c1-2-3-4-5(8)6(7)9/h5,8H,2-4H2,1H3,(H2,7,9)/t5-/m1/s1 |
| InChIKey | PWIXYTPZGNDAMG-RXMQYKEDSA-N |
| XLogP | 0.02 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-hydroxyhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-hydroxyhexanamide?
The IUPAC name of (2R)-2-hydroxyhexanamide (CID 78333430) is (2R)-2-hydroxyhexanamide.
What is the SMILES notation for (2R)-2-hydroxyhexanamide?
The canonical SMILES for (2R)-2-hydroxyhexanamide is CCCC[C@@H](O)C(N)=O.
What is the InChIKey of (2R)-2-hydroxyhexanamide?
The InChIKey is PWIXYTPZGNDAMG-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H13NO2/c1-2-3-4-5(8)6(7)9/h5,8H,2-4H2,1H3,(H2,7,9)/t5-/m1/s1.
What are the key properties of (2R)-2-hydroxyhexanamide?
(2R)-2-hydroxyhexanamide has a molecular weight of 131.17 g/mol, XLogP of 0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-hydroxyhexanamide is sourced from PubChem (CID 78333430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).