About (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine
(5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine (PubChem CID 78333432) has the molecular formula C12H20BrN
and a molecular weight of 258.20 g/mol. Its IUPAC name is (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine.
Molecular Properties
| Compound Name | (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine |
| PubChem CID | 78333432 |
| Molecular Formula | C12H20BrN |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine |
| SMILES | C[C@]12CC3(N)CC(Br)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C12H20BrN/c1-9-3-10(2)5-11(13,4-9)8-12(14,6-9)7-10/h3-8,14H2,1-2H3/t9-,10+,11?,12? |
| InChIKey | UKCUZUGMIJFTKF-ZYANWLCNSA-N |
| XLogP | 3.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine?
The IUPAC name of (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine (CID 78333432) is (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine.
What is the SMILES notation for (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine?
The canonical SMILES for (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine is C[C@]12CC3(N)CC(Br)(C1)C[C@@](C)(C3)C2.
What is the InChIKey of (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine?
The InChIKey is UKCUZUGMIJFTKF-ZYANWLCNSA-N. The full InChI is InChI=1S/C12H20BrN/c1-9-3-10(2)5-11(13,4-9)8-12(14,6-9)7-10/h3-8,14H2,1-2H3/t9-,10+,11?,12?.
What are the key properties of (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine?
(5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine has a molecular weight of 258.20 g/mol, XLogP of 3.21, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,7R)-3-bromo-5,7-dimethyladamantan-1-amine is sourced from PubChem (CID 78333432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).