About 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline
4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline (PubChem CID 783342) has the molecular formula C18H30N2
and a molecular weight of 274.45 g/mol. Its IUPAC name is 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline.
Molecular Properties
| Compound Name | 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline |
| PubChem CID | 783342 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline |
| SMILES | CCCN(Cc1ccc(N(CC)CC)cc1)CC1CC1 |
| InChI | InChI=1S/C18H30N2/c1-4-13-19(14-16-7-8-16)15-17-9-11-18(12-10-17)20(5-2)6-3/h9-12,16H,4-8,13-15H2,1-3H3 |
| InChIKey | WEVDWQPCAHFKGF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline?
The IUPAC name of 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline (CID 783342) is 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline.
What is the SMILES notation for 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline?
The canonical SMILES for 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline is CCCN(Cc1ccc(N(CC)CC)cc1)CC1CC1.
What is the InChIKey of 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline?
The InChIKey is WEVDWQPCAHFKGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2/c1-4-13-19(14-16-7-8-16)15-17-9-11-18(12-10-17)20(5-2)6-3/h9-12,16H,4-8,13-15H2,1-3H3.
What are the key properties of 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline?
4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline has a molecular weight of 274.45 g/mol, XLogP of 4.15, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[cyclopropylmethyl(propyl)amino]methyl]-N,N-diethylaniline is sourced from PubChem (CID 783342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).