C24H29N5O2 — CID 78335244
3-benzyl-9-(3,5-dimethylphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 78335244) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-benzyl-9-(3,5-dimethylphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 3-benzyl-9-(3,5-dimethylphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 78335244 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 3-benzyl-9-(3,5-dimethylphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | Cc1cc(C)cc(N2CCCN3C4C(=O)N(Cc5ccccc5)C(=O)N(C)C4NC23)c1 |
| InChI | InChI=1S/C24H29N5O2/c1-16-12-17(2)14-19(13-16)27-10-7-11-28-20-21(25-23(27)28)26(3)24(31)29(22(20)30)15-18-8-5-4-6-9-18/h4-6,8-9,12-14,20-21,23,25H,7,10-11,15H2,1-3H3 |
| InChIKey | BZVGTKYTDGSHSA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |