About (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium
(4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium (PubChem CID 78338615) has the molecular formula C6H11N2O3S+
and a molecular weight of 191.23 g/mol. Its IUPAC name is (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium.
Molecular Properties
| Compound Name | (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium |
| PubChem CID | 78338615 |
| Molecular Formula | C6H11N2O3S+ |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium |
| SMILES | C[S+](C)C1C(=O)NC(=O)NC1O |
| InChI | InChI=1S/C6H10N2O3S/c1-12(2)3-4(9)7-6(11)8-5(3)10/h3-4,9H,1-2H3,(H-,7,8,10,11)/p+1 |
| InChIKey | DOQYNWZPIFADQZ-UHFFFAOYSA-O |
| XLogP | -1.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium?
The IUPAC name of (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium (CID 78338615) is (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium.
What is the SMILES notation for (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium?
The canonical SMILES for (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium is C[S+](C)C1C(=O)NC(=O)NC1O.
What is the InChIKey of (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium?
The InChIKey is DOQYNWZPIFADQZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H10N2O3S/c1-12(2)3-4(9)7-6(11)8-5(3)10/h3-4,9H,1-2H3,(H-,7,8,10,11)/p+1.
What are the key properties of (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium?
(4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium has a molecular weight of 191.23 g/mol, XLogP of -1.61, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)-dimethylsulfanium is sourced from PubChem (CID 78338615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).