About N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide
N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide (PubChem CID 78340801) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide.
Molecular Properties
| Compound Name | N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide |
| PubChem CID | 78340801 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide |
| SMILES | O=C(CCN1C(=O)N=C2C=CC=CC2C1=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H21N3O3/c21-15(18-12-6-2-1-3-7-12)10-11-20-16(22)13-8-4-5-9-14(13)19-17(20)23/h4-5,8-9,12-13H,1-3,6-7,10-11H2,(H,18,21) |
| InChIKey | NDQVTXJBFWBVGA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide?
The IUPAC name of N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide (CID 78340801) is N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide.
What is the SMILES notation for N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide?
The canonical SMILES for N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide is O=C(CCN1C(=O)N=C2C=CC=CC2C1=O)NC1CCCCC1.
What is the InChIKey of N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide?
The InChIKey is NDQVTXJBFWBVGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3/c21-15(18-12-6-2-1-3-7-12)10-11-20-16(22)13-8-4-5-9-14(13)19-17(20)23/h4-5,8-9,12-13H,1-3,6-7,10-11H2,(H,18,21).
What are the key properties of N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide?
N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide has a molecular weight of 315.37 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-3-(2,4-dioxo-4aH-quinazolin-3-yl)propanamide is sourced from PubChem (CID 78340801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).