C19H26N7O2S+ — CID 78343082
1,3-dimethyl-8-(4-methylpiperidin-1-ium-1-ylidene)-7-(2-pyrimidin-2-ylsulfanylethyl)-5H-purine-2,6-dione (PubChem CID 78343082) has the molecular formula C19H26N7O2S+ and a molecular weight of 416.53 g/mol. Its IUPAC name is 1,3-dimethyl-8-(4-methylpiperidin-1-ium-1-ylidene)-7-(2-pyrimidin-2-ylsulfanylethyl)-5H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(4-methylpiperidin-1-ium-1-ylidene)-7-(2-pyrimidin-2-ylsulfanylethyl)-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 78343082 |
| Molecular Formula | C19H26N7O2S+ |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 1,3-dimethyl-8-(4-methylpiperidin-1-ium-1-ylidene)-7-(2-pyrimidin-2-ylsulfanylethyl)-5H-purine-2,6-dione |
| SMILES | CC1CC[N+](=C2N=C3C(C(=O)N(C)C(=O)N3C)N2CCSc2ncccn2)CC1 |
| InChI | InChI=1S/C19H26N7O2S/c1-13-5-9-25(10-6-13)18-22-15-14(16(27)24(3)19(28)23(15)2)26(18)11-12-29-17-20-7-4-8-21-17/h4,7-8,13-14H,5-6,9-12H2,1-3H3/q+1 |
| InChIKey | LCRGETQSLARJGX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 85.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|