C16H23NO3 — CID 7834380
2-(2-methoxyphenoxy)-N-[(1S,2R)-2-methylcyclohexyl]acetamide (PubChem CID 7834380) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[(1S,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-[(1S,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 7834380 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[(1S,2R)-2-methylcyclohexyl]acetamide |
| SMILES | COc1ccccc1OCC(=O)N[C@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C16H23NO3/c1-12-7-3-4-8-13(12)17-16(18)11-20-15-10-6-5-9-14(15)19-2/h5-6,9-10,12-13H,3-4,7-8,11H2,1-2H3,(H,17,18)/t12-,13+/m1/s1 |
| InChIKey | XNBBFYOTCSNHLL-OLZOCXBDSA-N |
| XLogP | 2.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |