C22H23N3O3S — CID 78350521
3-[(2-methoxyphenyl)methyl]-7-(piperidine-1-carbonyl)-2-sulfanylidene-4aH-quinazolin-4-one (PubChem CID 78350521) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)methyl]-7-(piperidine-1-carbonyl)-2-sulfanylidene-4aH-quinazolin-4-one.
| Compound Name | 3-[(2-methoxyphenyl)methyl]-7-(piperidine-1-carbonyl)-2-sulfanylidene-4aH-quinazolin-4-one |
|---|---|
| PubChem CID | 78350521 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-[(2-methoxyphenyl)methyl]-7-(piperidine-1-carbonyl)-2-sulfanylidene-4aH-quinazolin-4-one |
| SMILES | COc1ccccc1CN1C(=O)C2C=CC(C(=O)N3CCCCC3)=CC2=NC1=S |
| InChI | InChI=1S/C22H23N3O3S/c1-28-19-8-4-3-7-16(19)14-25-21(27)17-10-9-15(13-18(17)23-22(25)29)20(26)24-11-5-2-6-12-24/h3-4,7-10,13,17H,2,5-6,11-12,14H2,1H3 |
| InChIKey | RLSBIWONEPQLJD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|