C17H18BrNO3S — CID 7835054
[2-[[(1R)-1-(4-bromophenyl)propyl]amino]-2-oxoethyl] 3-methylthiophene-2-carboxylate (PubChem CID 7835054) has the molecular formula C17H18BrNO3S and a molecular weight of 396.31 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-bromophenyl)propyl]amino]-2-oxoethyl] 3-methylthiophene-2-carboxylate.
| Compound Name | [2-[[(1R)-1-(4-bromophenyl)propyl]amino]-2-oxoethyl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7835054 |
| Molecular Formula | C17H18BrNO3S |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | [2-[[(1R)-1-(4-bromophenyl)propyl]amino]-2-oxoethyl] 3-methylthiophene-2-carboxylate |
| SMILES | CC[C@@H](NC(=O)COC(=O)c1sccc1C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrNO3S/c1-3-14(12-4-6-13(18)7-5-12)19-15(20)10-22-17(21)16-11(2)8-9-23-16/h4-9,14H,3,10H2,1-2H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | DAKSHQDOMQUTFO-CQSZACIVSA-N |
| XLogP | 4.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |